C25H27N7O2 — CID 146667825
1-[1-[5-(3-cyano-6-ethoxypyrazolo[1,5-a]pyridin-4-yl)-2-pyridinyl]-4-methylpiperidin-4-yl]-3-prop-2-ynylurea (PubChem CID 146667825) has the molecular formula C25H27N7O2 and a molecular weight of 457.54 g/mol. Its IUPAC name is 1-[1-[5-(3-cyano-6-ethoxypyrazolo[1,5-a]pyridin-4-yl)-2-pyridinyl]-4-methylpiperidin-4-yl]-3-prop-2-ynylurea.
| Compound Name | 1-[1-[5-(3-cyano-6-ethoxypyrazolo[1,5-a]pyridin-4-yl)-2-pyridinyl]-4-methylpiperidin-4-yl]-3-prop-2-ynylurea |
|---|---|
| PubChem CID | 146667825 |
| Molecular Formula | C25H27N7O2 |
| Molecular Weight | 457.54 g/mol |
| Exact Mass | 457.22 |
| IUPAC Name | 1-[1-[5-(3-cyano-6-ethoxypyrazolo[1,5-a]pyridin-4-yl)-2-pyridinyl]-4-methylpiperidin-4-yl]-3-prop-2-ynylurea |
| SMILES | C#CCNC(=O)NC1(C)CCN(c2ccc(-c3cc(OCC)cn4ncc(C#N)c34)cn2)CC1 |
| InChI | InChI=1S/C25H27N7O2/c1-4-10-27-24(33)30-25(3)8-11-31(12-9-25)22-7-6-18(15-28-22)21-13-20(34-5-2)17-32-23(21)19(14-26)16-29-32/h1,6-7,13,15-17H,5,8-12H2,2-3H3,(H2,27,30,33) |
| InChIKey | QZJILQPRNUSKOS-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 107.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.54 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|