C21H22N6O3 — CID 146667890
N-[2-[[5-[3-cyano-6-(3-hydroxycyclobutyl)oxypyrazolo[1,5-a]pyridin-4-yl]-2-pyridinyl]amino]ethyl]acetamide (PubChem CID 146667890) has the molecular formula C21H22N6O3 and a molecular weight of 406.45 g/mol. Its IUPAC name is N-[2-[[5-[3-cyano-6-(3-hydroxycyclobutyl)oxypyrazolo[1,5-a]pyridin-4-yl]-2-pyridinyl]amino]ethyl]acetamide.
| Compound Name | N-[2-[[5-[3-cyano-6-(3-hydroxycyclobutyl)oxypyrazolo[1,5-a]pyridin-4-yl]-2-pyridinyl]amino]ethyl]acetamide |
|---|---|
| PubChem CID | 146667890 |
| Molecular Formula | C21H22N6O3 |
| Molecular Weight | 406.45 g/mol |
| Exact Mass | 406.18 |
| IUPAC Name | N-[2-[[5-[3-cyano-6-(3-hydroxycyclobutyl)oxypyrazolo[1,5-a]pyridin-4-yl]-2-pyridinyl]amino]ethyl]acetamide |
| SMILES | CC(=O)NCCNc1ccc(-c2cc(OC3CC(O)C3)cn3ncc(C#N)c23)cn1 |
| InChI | InChI=1S/C21H22N6O3/c1-13(28)23-4-5-24-20-3-2-14(10-25-20)19-8-18(30-17-6-16(29)7-17)12-27-21(19)15(9-22)11-26-27/h2-3,8,10-12,16-17,29H,4-7H2,1H3,(H,23,28)(H,24,25) |
| InChIKey | ISSGDWAIEXTRBS-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 124.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.45 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|