C21H24N2O3S — CID 14666811
(2R,3S,4R)-2-(4-methoxyphenyl)-N,N-dimethyl-6-(4-methylphenyl)-3-nitro-3,4-dihydro-2H-thiopyran-4-amine (PubChem CID 14666811) has the molecular formula C21H24N2O3S and a molecular weight of 384.50 g/mol. Its IUPAC name is (2R,3S,4R)-2-(4-methoxyphenyl)-N,N-dimethyl-6-(4-methylphenyl)-3-nitro-3,4-dihydro-2H-thiopyran-4-amine.
| Compound Name | (2R,3S,4R)-2-(4-methoxyphenyl)-N,N-dimethyl-6-(4-methylphenyl)-3-nitro-3,4-dihydro-2H-thiopyran-4-amine |
|---|---|
| PubChem CID | 14666811 |
| Molecular Formula | C21H24N2O3S |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | (2R,3S,4R)-2-(4-methoxyphenyl)-N,N-dimethyl-6-(4-methylphenyl)-3-nitro-3,4-dihydro-2H-thiopyran-4-amine |
| SMILES | COc1ccc([C@H]2SC(c3ccc(C)cc3)=C[C@@H](N(C)C)[C@@H]2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H24N2O3S/c1-14-5-7-15(8-6-14)19-13-18(22(2)3)20(23(24)25)21(27-19)16-9-11-17(26-4)12-10-16/h5-13,18,20-21H,1-4H3/t18-,20+,21-/m1/s1 |
| InChIKey | UKONXQXVSHTAJM-HLAWJBBLSA-N |
| XLogP | 4.41 |
| TPSA | 55.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|