About 3-nitro-2,6-diphenyl-2H-thiopyran
3-nitro-2,6-diphenyl-2H-thiopyran (PubChem CID 14666831) has the molecular formula C17H13NO2S
and a molecular weight of 295.36 g/mol. Its IUPAC name is 3-nitro-2,6-diphenyl-2H-thiopyran.
Molecular Properties
| Compound Name | 3-nitro-2,6-diphenyl-2H-thiopyran |
| PubChem CID | 14666831 |
| Molecular Formula | C17H13NO2S |
| Molecular Weight | 295.36 g/mol |
| Exact Mass | 295.07 |
| IUPAC Name | 3-nitro-2,6-diphenyl-2H-thiopyran |
| SMILES | O=[N+]([O-])C1=CC=C(c2ccccc2)SC1c1ccccc1 |
| InChI | InChI=1S/C17H13NO2S/c19-18(20)15-11-12-16(13-7-3-1-4-8-13)21-17(15)14-9-5-2-6-10-14/h1-12,17H |
| InChIKey | CWRUXIFNZRTLJP-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.36 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-nitro-2,6-diphenyl-2H-thiopyran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-nitro-2,6-diphenyl-2H-thiopyran?
The IUPAC name of 3-nitro-2,6-diphenyl-2H-thiopyran (CID 14666831) is 3-nitro-2,6-diphenyl-2H-thiopyran.
What is the SMILES notation for 3-nitro-2,6-diphenyl-2H-thiopyran?
The canonical SMILES for 3-nitro-2,6-diphenyl-2H-thiopyran is O=[N+]([O-])C1=CC=C(c2ccccc2)SC1c1ccccc1.
What is the InChIKey of 3-nitro-2,6-diphenyl-2H-thiopyran?
The InChIKey is CWRUXIFNZRTLJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13NO2S/c19-18(20)15-11-12-16(13-7-3-1-4-8-13)21-17(15)14-9-5-2-6-10-14/h1-12,17H.
What are the key properties of 3-nitro-2,6-diphenyl-2H-thiopyran?
3-nitro-2,6-diphenyl-2H-thiopyran has a molecular weight of 295.36 g/mol, XLogP of 4.68, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-nitro-2,6-diphenyl-2H-thiopyran is sourced from PubChem (CID 14666831), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).