About 2-(2-imino-1,3-thiazolidin-3-yl)-5-methoxyaniline;dihydrochloride
2-(2-imino-1,3-thiazolidin-3-yl)-5-methoxyaniline;dihydrochloride (PubChem CID 14666893) has the molecular formula C10H15Cl2N3OS
and a molecular weight of 296.22 g/mol. Its IUPAC name is 2-(2-imino-1,3-thiazolidin-3-yl)-5-methoxyaniline;dihydrochloride.
Molecular Properties
| Compound Name | 2-(2-imino-1,3-thiazolidin-3-yl)-5-methoxyaniline;dihydrochloride |
| PubChem CID | 14666893 |
| Molecular Formula | C10H15Cl2N3OS |
| Molecular Weight | 296.22 g/mol |
| Exact Mass | 295.03 |
| IUPAC Name | 2-(2-imino-1,3-thiazolidin-3-yl)-5-methoxyaniline;dihydrochloride |
| SMILES | Cl.Cl.[H]/N=C1\SCCN1c1ccc(OC)cc1N |
| InChI | InChI=1S/C10H13N3OS.2ClH/c1-14-7-2-3-9(8(11)6-7)13-4-5-15-10(13)12;;/h2-3,6,12H,4-5,11H2,1H3;2*1H/b12-10-;; |
| InChIKey | SNNLALDJSQLIMG-VSXCOVETSA-N |
| XLogP | 2.61 |
| TPSA | 62.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.22 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-imino-1,3-thiazolidin-3-yl)-5-methoxyaniline;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-imino-1,3-thiazolidin-3-yl)-5-methoxyaniline;dihydrochloride?
The IUPAC name of 2-(2-imino-1,3-thiazolidin-3-yl)-5-methoxyaniline;dihydrochloride (CID 14666893) is 2-(2-imino-1,3-thiazolidin-3-yl)-5-methoxyaniline;dihydrochloride.
What is the SMILES notation for 2-(2-imino-1,3-thiazolidin-3-yl)-5-methoxyaniline;dihydrochloride?
The canonical SMILES for 2-(2-imino-1,3-thiazolidin-3-yl)-5-methoxyaniline;dihydrochloride is Cl.Cl.[H]/N=C1\SCCN1c1ccc(OC)cc1N.
What is the InChIKey of 2-(2-imino-1,3-thiazolidin-3-yl)-5-methoxyaniline;dihydrochloride?
The InChIKey is SNNLALDJSQLIMG-VSXCOVETSA-N. The full InChI is InChI=1S/C10H13N3OS.2ClH/c1-14-7-2-3-9(8(11)6-7)13-4-5-15-10(13)12;;/h2-3,6,12H,4-5,11H2,1H3;2*1H/b12-10-;;.
What are the key properties of 2-(2-imino-1,3-thiazolidin-3-yl)-5-methoxyaniline;dihydrochloride?
2-(2-imino-1,3-thiazolidin-3-yl)-5-methoxyaniline;dihydrochloride has a molecular weight of 296.22 g/mol, XLogP of 2.61, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-imino-1,3-thiazolidin-3-yl)-5-methoxyaniline;dihydrochloride is sourced from PubChem (CID 14666893), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).