C19H23F5N4O2S — CID 146669555
tert-butyl N-[(1R,5S)-3,3-difluoro-5-[[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]amino]cyclohexyl]carbamate (PubChem CID 146669555) has the molecular formula C19H23F5N4O2S and a molecular weight of 466.48 g/mol. Its IUPAC name is tert-butyl N-[(1R,5S)-3,3-difluoro-5-[[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]amino]cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[(1R,5S)-3,3-difluoro-5-[[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]amino]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 146669555 |
| Molecular Formula | C19H23F5N4O2S |
| Molecular Weight | 466.48 g/mol |
| Exact Mass | 466.15 |
| IUPAC Name | tert-butyl N-[(1R,5S)-3,3-difluoro-5-[[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]amino]cyclohexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1C[C@H](Nc2ncnc3sc(CC(F)(F)F)cc23)CC(F)(F)C1 |
| InChI | InChI=1S/C19H23F5N4O2S/c1-17(2,3)30-16(29)28-11-4-10(6-18(20,21)7-11)27-14-13-5-12(8-19(22,23)24)31-15(13)26-9-25-14/h5,9-11H,4,6-8H2,1-3H3,(H,28,29)(H,25,26,27)/t10-,11+/m0/s1 |
| InChIKey | UWOMVYLUWAOTJP-WDEREUQCSA-N |
| XLogP | 5.29 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.48 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |