C17H18F3N5OS — CID 146669624
5-(1,3-oxazol-2-yl)-3-N-[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]cyclohexane-1,3-diamine (PubChem CID 146669624) has the molecular formula C17H18F3N5OS and a molecular weight of 397.43 g/mol. Its IUPAC name is 5-(1,3-oxazol-2-yl)-3-N-[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]cyclohexane-1,3-diamine.
| Compound Name | 5-(1,3-oxazol-2-yl)-3-N-[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]cyclohexane-1,3-diamine |
|---|---|
| PubChem CID | 146669624 |
| Molecular Formula | C17H18F3N5OS |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.12 |
| IUPAC Name | 5-(1,3-oxazol-2-yl)-3-N-[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]cyclohexane-1,3-diamine |
| SMILES | NC1CC(Nc2ncnc3sc(CC(F)(F)F)cc23)CC(c2ncco2)C1 |
| InChI | InChI=1S/C17H18F3N5OS/c18-17(19,20)7-12-6-13-14(23-8-24-16(13)27-12)25-11-4-9(3-10(21)5-11)15-22-1-2-26-15/h1-2,6,8-11H,3-5,7,21H2,(H,23,24,25) |
| InChIKey | IBYPJFYHUSVRCK-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 89.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |