C28H26F3N5OS — CID 146669637
(3R)-1-N-[(4-furo[3,2-b]pyridin-6-ylphenyl)methyl]-3-N-methyl-3-N-[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]cyclopentane-1,3-diamine (PubChem CID 146669637) has the molecular formula C28H26F3N5OS and a molecular weight of 537.61 g/mol. Its IUPAC name is (3R)-1-N-[(4-furo[3,2-b]pyridin-6-ylphenyl)methyl]-3-N-methyl-3-N-[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]cyclopentane-1,3-diamine.
| Compound Name | (3R)-1-N-[(4-furo[3,2-b]pyridin-6-ylphenyl)methyl]-3-N-methyl-3-N-[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]cyclopentane-1,3-diamine |
|---|---|
| PubChem CID | 146669637 |
| Molecular Formula | C28H26F3N5OS |
| Molecular Weight | 537.61 g/mol |
| Exact Mass | 537.18 |
| IUPAC Name | (3R)-1-N-[(4-furo[3,2-b]pyridin-6-ylphenyl)methyl]-3-N-methyl-3-N-[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]cyclopentane-1,3-diamine |
| SMILES | CN(c1ncnc2sc(CC(F)(F)F)cc12)[C@@H]1CCC(NCc2ccc(-c3cnc4ccoc4c3)cc2)C1 |
| InChI | InChI=1S/C28H26F3N5OS/c1-36(26-23-12-22(13-28(29,30)31)38-27(23)35-16-34-26)21-7-6-20(11-21)32-14-17-2-4-18(5-3-17)19-10-25-24(33-15-19)8-9-37-25/h2-5,8-10,12,15-16,20-21,32H,6-7,11,13-14H2,1H3/t20?,21-/m1/s1 |
| InChIKey | LHUWMKCAUZSWEL-BPGUCPLFSA-N |
| XLogP | 6.75 |
| TPSA | 67.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.61 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |