C27H28F3N5OS — CID 146669999
cis-(1S,3R)-1-N-[[4-(5-methoxy-3-pyridinyl)phenyl]methyl]-3-N-methyl-3-N-[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]cyclopentane-1,3-diamine (PubChem CID 146669999) has the molecular formula C27H28F3N5OS and a molecular weight of 527.62 g/mol. Its IUPAC name is cis-(1S,3R)-1-N-[[4-(5-methoxy-3-pyridinyl)phenyl]methyl]-3-N-methyl-3-N-[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]cyclopentane-1,3-diamine.
| Compound Name | cis-(1S,3R)-1-N-[[4-(5-methoxy-3-pyridinyl)phenyl]methyl]-3-N-methyl-3-N-[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]cyclopentane-1,3-diamine |
|---|---|
| PubChem CID | 146669999 |
| Molecular Formula | C27H28F3N5OS |
| Molecular Weight | 527.62 g/mol |
| Exact Mass | 527.20 |
| IUPAC Name | cis-(1S,3R)-1-N-[[4-(5-methoxy-3-pyridinyl)phenyl]methyl]-3-N-methyl-3-N-[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]cyclopentane-1,3-diamine |
| SMILES | COc1cncc(-c2ccc(CN[C@H]3CC[C@@H](N(C)c4ncnc5sc(CC(F)(F)F)cc45)C3)cc2)c1 |
| InChI | InChI=1S/C27H28F3N5OS/c1-35(25-24-11-23(12-27(28,29)30)37-26(24)34-16-33-25)21-8-7-20(10-21)32-13-17-3-5-18(6-4-17)19-9-22(36-2)15-31-14-19/h3-6,9,11,14-16,20-21,32H,7-8,10,12-13H2,1-2H3/t20-,21+/m0/s1 |
| InChIKey | OOMPKQVEUHODFV-LEWJYISDSA-N |
| XLogP | 6.01 |
| TPSA | 63.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.62 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |