C21H26N6O2S — CID 146670466
1-[4-[4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]pyrrolo[2,1-f][1,2,4]triazin-2-yl]phenyl]-3-(2-hydroxyethyl)thiourea (PubChem CID 146670466) has the molecular formula C21H26N6O2S and a molecular weight of 426.55 g/mol. Its IUPAC name is 1-[4-[4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]pyrrolo[2,1-f][1,2,4]triazin-2-yl]phenyl]-3-(2-hydroxyethyl)thiourea.
| Compound Name | 1-[4-[4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]pyrrolo[2,1-f][1,2,4]triazin-2-yl]phenyl]-3-(2-hydroxyethyl)thiourea |
|---|---|
| PubChem CID | 146670466 |
| Molecular Formula | C21H26N6O2S |
| Molecular Weight | 426.55 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | 1-[4-[4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]pyrrolo[2,1-f][1,2,4]triazin-2-yl]phenyl]-3-(2-hydroxyethyl)thiourea |
| SMILES | C[C@@H]1CN(c2nc(-c3ccc(NC(=S)NCCO)cc3)nn3cccc23)C[C@H](C)O1 |
| InChI | InChI=1S/C21H26N6O2S/c1-14-12-26(13-15(2)29-14)20-18-4-3-10-27(18)25-19(24-20)16-5-7-17(8-6-16)23-21(30)22-9-11-28/h3-8,10,14-15,28H,9,11-13H2,1-2H3,(H2,22,23,30)/t14-,15+ |
| InChIKey | CFGPWFLKFPYDPM-GASCZTMLSA-N |
| XLogP | 2.29 |
| TPSA | 86.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.55 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|