C48H32N4O — CID 146670543
6-[3-[4-(2,6-diphenylpyrimidin-4-yl)phenyl]phenyl]-2-phenyl-1,2-dihydro-[1,3]oxazolo[5,4-k]phenanthridine (PubChem CID 146670543) has the molecular formula C48H32N4O and a molecular weight of 680.81 g/mol. Its IUPAC name is 6-[3-[4-(2,6-diphenylpyrimidin-4-yl)phenyl]phenyl]-2-phenyl-1,2-dihydro-[1,3]oxazolo[5,4-k]phenanthridine.
| Compound Name | 6-[3-[4-(2,6-diphenylpyrimidin-4-yl)phenyl]phenyl]-2-phenyl-1,2-dihydro-[1,3]oxazolo[5,4-k]phenanthridine |
|---|---|
| PubChem CID | 146670543 |
| Molecular Formula | C48H32N4O |
| Molecular Weight | 680.81 g/mol |
| Exact Mass | 680.26 |
| IUPAC Name | 6-[3-[4-(2,6-diphenylpyrimidin-4-yl)phenyl]phenyl]-2-phenyl-1,2-dihydro-[1,3]oxazolo[5,4-k]phenanthridine |
| SMILES | c1ccc(-c2cc(-c3ccc(-c4cccc(-c5nc6ccccc6c6c7c(ccc56)OC(c5ccccc5)N7)c4)cc3)nc(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C48H32N4O/c1-4-13-32(14-5-1)41-30-42(51-47(50-41)34-15-6-2-7-16-34)33-25-23-31(24-26-33)36-19-12-20-37(29-36)45-39-27-28-43-46(44(39)38-21-10-11-22-40(38)49-45)52-48(53-43)35-17-8-3-9-18-35/h1-30,48,52H |
| InChIKey | OAFMIEJHPCTGDP-UHFFFAOYSA-N |
| XLogP | 12.02 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.81 |
| LogP ≤ 5 | 12.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|