C20H16ClFN4O2 — CID 146671128
4-chloro-7-(3-fluorophenyl)-5-[6-(2-methoxyethoxy)-3-pyridinyl]pyrrolo[2,3-d]pyrimidine (PubChem CID 146671128) has the molecular formula C20H16ClFN4O2 and a molecular weight of 398.83 g/mol. Its IUPAC name is 4-chloro-7-(3-fluorophenyl)-5-[6-(2-methoxyethoxy)-3-pyridinyl]pyrrolo[2,3-d]pyrimidine.
| Compound Name | 4-chloro-7-(3-fluorophenyl)-5-[6-(2-methoxyethoxy)-3-pyridinyl]pyrrolo[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 146671128 |
| Molecular Formula | C20H16ClFN4O2 |
| Molecular Weight | 398.83 g/mol |
| Exact Mass | 398.09 |
| IUPAC Name | 4-chloro-7-(3-fluorophenyl)-5-[6-(2-methoxyethoxy)-3-pyridinyl]pyrrolo[2,3-d]pyrimidine |
| SMILES | COCCOc1ccc(-c2cn(-c3cccc(F)c3)c3ncnc(Cl)c23)cn1 |
| InChI | InChI=1S/C20H16ClFN4O2/c1-27-7-8-28-17-6-5-13(10-23-17)16-11-26(15-4-2-3-14(22)9-15)20-18(16)19(21)24-12-25-20/h2-6,9-12H,7-8H2,1H3 |
| InChIKey | AKHKYPNJYSOYGK-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 62.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.83 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|