C46H45N3S — CID 146671654
(1E,3E)-4-cyclohexa-1,5-dien-1-yl-2-[cyclohexa-1,5-dien-1-yl-phenyl-[9-(2-phenyl-1,2-dihydropyridin-6-yl)-1,2-dihydrocarbazol-3-yl]-λ4-sulfanyl]penta-1,3-dien-1-amine (PubChem CID 146671654) has the molecular formula C46H45N3S and a molecular weight of 671.95 g/mol. Its IUPAC name is (1E,3E)-4-cyclohexa-1,5-dien-1-yl-2-[cyclohexa-1,5-dien-1-yl-phenyl-[9-(2-phenyl-1,2-dihydropyridin-6-yl)-1,2-dihydrocarbazol-3-yl]-λ4-sulfanyl]penta-1,3-dien-1-amine.
| Compound Name | (1E,3E)-4-cyclohexa-1,5-dien-1-yl-2-[cyclohexa-1,5-dien-1-yl-phenyl-[9-(2-phenyl-1,2-dihydropyridin-6-yl)-1,2-dihydrocarbazol-3-yl]-λ4-sulfanyl]penta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 146671654 |
| Molecular Formula | C46H45N3S |
| Molecular Weight | 671.95 g/mol |
| Exact Mass | 671.33 |
| IUPAC Name | (1E,3E)-4-cyclohexa-1,5-dien-1-yl-2-[cyclohexa-1,5-dien-1-yl-phenyl-[9-(2-phenyl-1,2-dihydropyridin-6-yl)-1,2-dihydrocarbazol-3-yl]-λ4-sulfanyl]penta-1,3-dien-1-amine |
| SMILES | C/C(=C\C(=C/N)S(C1=CCCC=C1)(C1=Cc2c(n(C3=CC=CC(c4ccccc4)N3)c3ccccc23)CC1)c1ccccc1)C1=CCCC=C1 |
| InChI | InChI=1S/C46H45N3S/c1-34(35-17-6-2-7-18-35)31-40(33-47)50(37-21-10-4-11-22-37,38-23-12-5-13-24-38)39-29-30-45-42(32-39)41-25-14-15-27-44(41)49(45)46-28-16-26-43(48-46)36-19-8-3-9-20-36/h3-4,6,8-12,14-28,31-33,43,48H,2,5,7,13,29-30,47H2,1H3/b34-31+,40-33+ |
| InChIKey | OQFJYXUACQJGEY-ZBVFTNSSSA-N |
| XLogP | 11.75 |
| TPSA | 42.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.95 |
| LogP ≤ 5 | 11.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|