C16H20OS — CID 146671697
(1E,4Z)-1-[4-ethenyl-3-methyl-5-[(Z)-prop-1-enyl]furan-2-yl]hexa-1,4-diene-2-thiol (PubChem CID 146671697) has the molecular formula C16H20OS and a molecular weight of 260.40 g/mol. Its IUPAC name is (1E,4Z)-1-[4-ethenyl-3-methyl-5-[(Z)-prop-1-enyl]furan-2-yl]hexa-1,4-diene-2-thiol.
| Compound Name | (1E,4Z)-1-[4-ethenyl-3-methyl-5-[(Z)-prop-1-enyl]furan-2-yl]hexa-1,4-diene-2-thiol |
|---|---|
| PubChem CID | 146671697 |
| Molecular Formula | C16H20OS |
| Molecular Weight | 260.40 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | (1E,4Z)-1-[4-ethenyl-3-methyl-5-[(Z)-prop-1-enyl]furan-2-yl]hexa-1,4-diene-2-thiol |
| SMILES | C=Cc1c(/C=C\C)oc(/C=C(/S)C/C=C\C)c1C |
| InChI | InChI=1S/C16H20OS/c1-5-8-10-13(18)11-16-12(4)14(7-3)15(17-16)9-6-2/h5-9,11,18H,3,10H2,1-2,4H3/b8-5-,9-6-,13-11+ |
| InChIKey | UPRORXOBMHREEO-ZVTARGMXSA-N |
| XLogP | 5.50 |
| TPSA | 13.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.40 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|