C14H16ClN3OS — CID 146671786
4-chloro-6-[[4-(ethylsulfanylmethyl)phenyl]methoxy]pyrimidin-2-amine (PubChem CID 146671786) has the molecular formula C14H16ClN3OS and a molecular weight of 309.82 g/mol. Its IUPAC name is 4-chloro-6-[[4-(ethylsulfanylmethyl)phenyl]methoxy]pyrimidin-2-amine.
| Compound Name | 4-chloro-6-[[4-(ethylsulfanylmethyl)phenyl]methoxy]pyrimidin-2-amine |
|---|---|
| PubChem CID | 146671786 |
| Molecular Formula | C14H16ClN3OS |
| Molecular Weight | 309.82 g/mol |
| Exact Mass | 309.07 |
| IUPAC Name | 4-chloro-6-[[4-(ethylsulfanylmethyl)phenyl]methoxy]pyrimidin-2-amine |
| SMILES | CCSCc1ccc(COc2cc(Cl)nc(N)n2)cc1 |
| InChI | InChI=1S/C14H16ClN3OS/c1-2-20-9-11-5-3-10(4-6-11)8-19-13-7-12(15)17-14(16)18-13/h3-7H,2,8-9H2,1H3,(H2,16,17,18) |
| InChIKey | GZFXVVYUIAIRAT-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.82 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |