About 6-[[(3Z)-hexa-1,3-dien-2-yl]-[(Z)-pent-3-en-2-yl]amino]hexan-1-ol
6-[[(3Z)-hexa-1,3-dien-2-yl]-[(Z)-pent-3-en-2-yl]amino]hexan-1-ol (PubChem CID 146671958) has the molecular formula C17H31NO
and a molecular weight of 265.44 g/mol. Its IUPAC name is 6-[[(3Z)-hexa-1,3-dien-2-yl]-[(Z)-pent-3-en-2-yl]amino]hexan-1-ol.
Molecular Properties
| Compound Name | 6-[[(3Z)-hexa-1,3-dien-2-yl]-[(Z)-pent-3-en-2-yl]amino]hexan-1-ol |
| PubChem CID | 146671958 |
| Molecular Formula | C17H31NO |
| Molecular Weight | 265.44 g/mol |
| Exact Mass | 265.24 |
| IUPAC Name | 6-[[(3Z)-hexa-1,3-dien-2-yl]-[(Z)-pent-3-en-2-yl]amino]hexan-1-ol |
| SMILES | C=C(/C=C\CC)N(CCCCCCO)C(C)/C=C\C |
| InChI | InChI=1S/C17H31NO/c1-5-7-13-17(4)18(16(3)12-6-2)14-10-8-9-11-15-19/h6-7,12-13,16,19H,4-5,8-11,14-15H2,1-3H3/b12-6-,13-7- |
| InChIKey | IRCSZXNIDFYSRX-QXFGSWAMSA-N |
| XLogP | 4.29 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.44 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 6-[[(3Z)-hexa-1,3-dien-2-yl]-[(Z)-pent-3-en-2-yl]amino]hexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[[(3Z)-hexa-1,3-dien-2-yl]-[(Z)-pent-3-en-2-yl]amino]hexan-1-ol?
The IUPAC name of 6-[[(3Z)-hexa-1,3-dien-2-yl]-[(Z)-pent-3-en-2-yl]amino]hexan-1-ol (CID 146671958) is 6-[[(3Z)-hexa-1,3-dien-2-yl]-[(Z)-pent-3-en-2-yl]amino]hexan-1-ol.
What is the SMILES notation for 6-[[(3Z)-hexa-1,3-dien-2-yl]-[(Z)-pent-3-en-2-yl]amino]hexan-1-ol?
The canonical SMILES for 6-[[(3Z)-hexa-1,3-dien-2-yl]-[(Z)-pent-3-en-2-yl]amino]hexan-1-ol is C=C(/C=C\CC)N(CCCCCCO)C(C)/C=C\C.
What is the InChIKey of 6-[[(3Z)-hexa-1,3-dien-2-yl]-[(Z)-pent-3-en-2-yl]amino]hexan-1-ol?
The InChIKey is IRCSZXNIDFYSRX-QXFGSWAMSA-N. The full InChI is InChI=1S/C17H31NO/c1-5-7-13-17(4)18(16(3)12-6-2)14-10-8-9-11-15-19/h6-7,12-13,16,19H,4-5,8-11,14-15H2,1-3H3/b12-6-,13-7-.
What are the key properties of 6-[[(3Z)-hexa-1,3-dien-2-yl]-[(Z)-pent-3-en-2-yl]amino]hexan-1-ol?
6-[[(3Z)-hexa-1,3-dien-2-yl]-[(Z)-pent-3-en-2-yl]amino]hexan-1-ol has a molecular weight of 265.44 g/mol, XLogP of 4.29, 11 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[[(3Z)-hexa-1,3-dien-2-yl]-[(Z)-pent-3-en-2-yl]amino]hexan-1-ol is sourced from PubChem (CID 146671958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).