C15H21O2- — CID 146672906
(2E)-2-[(3aR,8aS)-3a,6-dimethyl-2,3,4,5,8,8a-hexahydroazulen-1-ylidene]propanoate (PubChem CID 146672906) has the molecular formula C15H21O2- and a molecular weight of 233.33 g/mol. Its IUPAC name is (2E)-2-[(3aR,8aS)-3a,6-dimethyl-2,3,4,5,8,8a-hexahydroazulen-1-ylidene]propanoate.
| Compound Name | (2E)-2-[(3aR,8aS)-3a,6-dimethyl-2,3,4,5,8,8a-hexahydroazulen-1-ylidene]propanoate |
|---|---|
| PubChem CID | 146672906 |
| Molecular Formula | C15H21O2- |
| Molecular Weight | 233.33 g/mol |
| Exact Mass | 233.15 |
| IUPAC Name | (2E)-2-[(3aR,8aS)-3a,6-dimethyl-2,3,4,5,8,8a-hexahydroazulen-1-ylidene]propanoate |
| SMILES | CC1=CC[C@@H]2/C(=C(\C)C(=O)[O-])CC[C@@]2(C)CC1 |
| InChI | InChI=1S/C15H22O2/c1-10-4-5-13-12(11(2)14(16)17)7-9-15(13,3)8-6-10/h4,13H,5-9H2,1-3H3,(H,16,17)/p-1/b12-11+/t13-,15-/m1/s1 |
| InChIKey | KFDDUAXEWGCSIT-QXFGWPSGSA-M |
| XLogP | 2.60 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.33 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|