C15H21O3- — CID 146672908
(2E)-2-[(3aR,4S,8aR)-4-hydroxy-3a,6-dimethyl-2,3,4,5,8,8a-hexahydroazulen-1-ylidene]propanoate (PubChem CID 146672908) has the molecular formula C15H21O3- and a molecular weight of 249.33 g/mol. Its IUPAC name is (2E)-2-[(3aR,4S,8aR)-4-hydroxy-3a,6-dimethyl-2,3,4,5,8,8a-hexahydroazulen-1-ylidene]propanoate.
| Compound Name | (2E)-2-[(3aR,4S,8aR)-4-hydroxy-3a,6-dimethyl-2,3,4,5,8,8a-hexahydroazulen-1-ylidene]propanoate |
|---|---|
| PubChem CID | 146672908 |
| Molecular Formula | C15H21O3- |
| Molecular Weight | 249.33 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | (2E)-2-[(3aR,4S,8aR)-4-hydroxy-3a,6-dimethyl-2,3,4,5,8,8a-hexahydroazulen-1-ylidene]propanoate |
| SMILES | CC1=CC[C@@H]2/C(=C(\C)C(=O)[O-])CC[C@@]2(C)[C@@H](O)C1 |
| InChI | InChI=1S/C15H22O3/c1-9-4-5-12-11(10(2)14(17)18)6-7-15(12,3)13(16)8-9/h4,12-13,16H,5-8H2,1-3H3,(H,17,18)/p-1/b11-10+/t12-,13+,15-/m1/s1 |
| InChIKey | UBTZCHHLMCBTIV-WDHFGGHWSA-M |
| XLogP | 1.57 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.33 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|