C15H21O4- — CID 146672911
(2E)-2-[(3R,3aR,4S,8aR)-3,4-dihydroxy-3a,6-dimethyl-2,3,4,5,8,8a-hexahydroazulen-1-ylidene]propanoate (PubChem CID 146672911) has the molecular formula C15H21O4- and a molecular weight of 265.33 g/mol. Its IUPAC name is (2E)-2-[(3R,3aR,4S,8aR)-3,4-dihydroxy-3a,6-dimethyl-2,3,4,5,8,8a-hexahydroazulen-1-ylidene]propanoate.
| Compound Name | (2E)-2-[(3R,3aR,4S,8aR)-3,4-dihydroxy-3a,6-dimethyl-2,3,4,5,8,8a-hexahydroazulen-1-ylidene]propanoate |
|---|---|
| PubChem CID | 146672911 |
| Molecular Formula | C15H21O4- |
| Molecular Weight | 265.33 g/mol |
| Exact Mass | 265.14 |
| IUPAC Name | (2E)-2-[(3R,3aR,4S,8aR)-3,4-dihydroxy-3a,6-dimethyl-2,3,4,5,8,8a-hexahydroazulen-1-ylidene]propanoate |
| SMILES | CC1=CC[C@@H]2/C(=C(\C)C(=O)[O-])C[C@@H](O)[C@@]2(C)[C@@H](O)C1 |
| InChI | InChI=1S/C15H22O4/c1-8-4-5-11-10(9(2)14(18)19)7-13(17)15(11,3)12(16)6-8/h4,11-13,16-17H,5-7H2,1-3H3,(H,18,19)/p-1/b10-9+/t11-,12+,13-,15-/m1/s1 |
| InChIKey | SFKVYZKKPMSRCR-JBOWGTNDSA-M |
| XLogP | 0.54 |
| TPSA | 80.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.33 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|