C23H18N2O4 — CID 146673478
16-methoxy-11-methyl-6-(pyridin-2-ylmethoxy)-2-oxa-11-azatetracyclo[8.6.1.03,8.013,17]heptadeca-1(16),3(8),4,6,9,13(17),14-heptaen-12-one (PubChem CID 146673478) has the molecular formula C23H18N2O4 and a molecular weight of 386.41 g/mol. Its IUPAC name is 16-methoxy-11-methyl-6-(pyridin-2-ylmethoxy)-2-oxa-11-azatetracyclo[8.6.1.03,8.013,17]heptadeca-1(16),3(8),4,6,9,13(17),14-heptaen-12-one.
| Compound Name | 16-methoxy-11-methyl-6-(pyridin-2-ylmethoxy)-2-oxa-11-azatetracyclo[8.6.1.03,8.013,17]heptadeca-1(16),3(8),4,6,9,13(17),14-heptaen-12-one |
|---|---|
| PubChem CID | 146673478 |
| Molecular Formula | C23H18N2O4 |
| Molecular Weight | 386.41 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | 16-methoxy-11-methyl-6-(pyridin-2-ylmethoxy)-2-oxa-11-azatetracyclo[8.6.1.03,8.013,17]heptadeca-1(16),3(8),4,6,9,13(17),14-heptaen-12-one |
| SMILES | COc1ccc2c3c1Oc1ccc(OCc4ccccn4)cc1C=C3N(C)C2=O |
| InChI | InChI=1S/C23H18N2O4/c1-25-18-12-14-11-16(28-13-15-5-3-4-10-24-15)6-8-19(14)29-22-20(27-2)9-7-17(21(18)22)23(25)26/h3-12H,13H2,1-2H3 |
| InChIKey | HNCQBIVHPUSTSM-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 60.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.41 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|