C12H17NO5 — CID 146673482
[(6S)-6-hydroxy-4-nitrocyclohexa-2,4-dien-1-yl] hexanoate (PubChem CID 146673482) has the molecular formula C12H17NO5 and a molecular weight of 255.27 g/mol. Its IUPAC name is [(6S)-6-hydroxy-4-nitrocyclohexa-2,4-dien-1-yl] hexanoate.
| Compound Name | [(6S)-6-hydroxy-4-nitrocyclohexa-2,4-dien-1-yl] hexanoate |
|---|---|
| PubChem CID | 146673482 |
| Molecular Formula | C12H17NO5 |
| Molecular Weight | 255.27 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | [(6S)-6-hydroxy-4-nitrocyclohexa-2,4-dien-1-yl] hexanoate |
| SMILES | CCCCCC(=O)OC1C=CC([N+](=O)[O-])=C[C@@H]1O |
| InChI | InChI=1S/C12H17NO5/c1-2-3-4-5-12(15)18-11-7-6-9(13(16)17)8-10(11)14/h6-8,10-11,14H,2-5H2,1H3/t10-,11?/m0/s1 |
| InChIKey | CGXPUCJVKKVNTL-VUWPPUDQSA-N |
| XLogP | 1.57 |
| TPSA | 89.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.27 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|