C26H19N5O3S2 — CID 146673698
3-amino-N-[(E)-(4-methylphenyl)methylideneamino]-6-(4-nitrophenyl)-4-thiophen-2-ylthieno[2,3-b]pyridine-2-carboxamide (PubChem CID 146673698) has the molecular formula C26H19N5O3S2 and a molecular weight of 513.60 g/mol. Its IUPAC name is 3-amino-N-[(E)-(4-methylphenyl)methylideneamino]-6-(4-nitrophenyl)-4-thiophen-2-ylthieno[2,3-b]pyridine-2-carboxamide.
| Compound Name | 3-amino-N-[(E)-(4-methylphenyl)methylideneamino]-6-(4-nitrophenyl)-4-thiophen-2-ylthieno[2,3-b]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 146673698 |
| Molecular Formula | C26H19N5O3S2 |
| Molecular Weight | 513.60 g/mol |
| Exact Mass | 513.09 |
| IUPAC Name | 3-amino-N-[(E)-(4-methylphenyl)methylideneamino]-6-(4-nitrophenyl)-4-thiophen-2-ylthieno[2,3-b]pyridine-2-carboxamide |
| SMILES | Cc1ccc(/C=N/NC(=O)c2sc3nc(-c4ccc([N+](=O)[O-])cc4)cc(-c4cccs4)c3c2N)cc1 |
| InChI | InChI=1S/C26H19N5O3S2/c1-15-4-6-16(7-5-15)14-28-30-25(32)24-23(27)22-19(21-3-2-12-35-21)13-20(29-26(22)36-24)17-8-10-18(11-9-17)31(33)34/h2-14H,27H2,1H3,(H,30,32)/b28-14+ |
| InChIKey | OISOBJXNSXAIAI-CCVNUDIWSA-N |
| XLogP | 6.25 |
| TPSA | 123.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.60 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|