About 2-methyl-6,7-dithiophen-2-yl-8H-imidazo[4,5-g]quinoxaline
2-methyl-6,7-dithiophen-2-yl-8H-imidazo[4,5-g]quinoxaline (PubChem CID 146673760) has the molecular formula C18H12N4S2
and a molecular weight of 348.46 g/mol. Its IUPAC name is 2-methyl-6,7-dithiophen-2-yl-8H-imidazo[4,5-g]quinoxaline.
Molecular Properties
| Compound Name | 2-methyl-6,7-dithiophen-2-yl-8H-imidazo[4,5-g]quinoxaline |
| PubChem CID | 146673760 |
| Molecular Formula | C18H12N4S2 |
| Molecular Weight | 348.46 g/mol |
| Exact Mass | 348.05 |
| IUPAC Name | 2-methyl-6,7-dithiophen-2-yl-8H-imidazo[4,5-g]quinoxaline |
| SMILES | Cc1nc2cc3nc(-c4cccs4)c(-c4cccs4)[nH]c3cc2n1 |
| InChI | InChI=1S/C18H12N4S2/c1-10-19-11-8-13-14(9-12(11)20-10)22-18(16-5-3-7-24-16)17(21-13)15-4-2-6-23-15/h2-9,21H,1H3 |
| InChIKey | QMWYMHINABKHBM-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 348.46 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-methyl-6,7-dithiophen-2-yl-8H-imidazo[4,5-g]quinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-6,7-dithiophen-2-yl-8H-imidazo[4,5-g]quinoxaline?
The IUPAC name of 2-methyl-6,7-dithiophen-2-yl-8H-imidazo[4,5-g]quinoxaline (CID 146673760) is 2-methyl-6,7-dithiophen-2-yl-8H-imidazo[4,5-g]quinoxaline.
What is the SMILES notation for 2-methyl-6,7-dithiophen-2-yl-8H-imidazo[4,5-g]quinoxaline?
The canonical SMILES for 2-methyl-6,7-dithiophen-2-yl-8H-imidazo[4,5-g]quinoxaline is Cc1nc2cc3nc(-c4cccs4)c(-c4cccs4)[nH]c3cc2n1.
What is the InChIKey of 2-methyl-6,7-dithiophen-2-yl-8H-imidazo[4,5-g]quinoxaline?
The InChIKey is QMWYMHINABKHBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12N4S2/c1-10-19-11-8-13-14(9-12(11)20-10)22-18(16-5-3-7-24-16)17(21-13)15-4-2-6-23-15/h2-9,21H,1H3.
What are the key properties of 2-methyl-6,7-dithiophen-2-yl-8H-imidazo[4,5-g]quinoxaline?
2-methyl-6,7-dithiophen-2-yl-8H-imidazo[4,5-g]quinoxaline has a molecular weight of 348.46 g/mol, XLogP of 5.27, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-6,7-dithiophen-2-yl-8H-imidazo[4,5-g]quinoxaline is sourced from PubChem (CID 146673760), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).