About 1-(3-bromopropyl)-3,4-dimethylpyrrole-2,5-dione
1-(3-bromopropyl)-3,4-dimethylpyrrole-2,5-dione (PubChem CID 146673829) has the molecular formula C9H12BrNO2
and a molecular weight of 246.10 g/mol. Its IUPAC name is 1-(3-bromopropyl)-3,4-dimethylpyrrole-2,5-dione.
Molecular Properties
| Compound Name | 1-(3-bromopropyl)-3,4-dimethylpyrrole-2,5-dione |
| PubChem CID | 146673829 |
| Molecular Formula | C9H12BrNO2 |
| Molecular Weight | 246.10 g/mol |
| Exact Mass | 245.01 |
| IUPAC Name | 1-(3-bromopropyl)-3,4-dimethylpyrrole-2,5-dione |
| SMILES | CC1=C(C)C(=O)N(CCCBr)C1=O |
| InChI | InChI=1S/C9H12BrNO2/c1-6-7(2)9(13)11(8(6)12)5-3-4-10/h3-5H2,1-2H3 |
| InChIKey | JELXLHVZWILNNY-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.10 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 1-(3-bromopropyl)-3,4-dimethylpyrrole-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-bromopropyl)-3,4-dimethylpyrrole-2,5-dione?
The IUPAC name of 1-(3-bromopropyl)-3,4-dimethylpyrrole-2,5-dione (CID 146673829) is 1-(3-bromopropyl)-3,4-dimethylpyrrole-2,5-dione.
What is the SMILES notation for 1-(3-bromopropyl)-3,4-dimethylpyrrole-2,5-dione?
The canonical SMILES for 1-(3-bromopropyl)-3,4-dimethylpyrrole-2,5-dione is CC1=C(C)C(=O)N(CCCBr)C1=O.
What is the InChIKey of 1-(3-bromopropyl)-3,4-dimethylpyrrole-2,5-dione?
The InChIKey is JELXLHVZWILNNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12BrNO2/c1-6-7(2)9(13)11(8(6)12)5-3-4-10/h3-5H2,1-2H3.
What are the key properties of 1-(3-bromopropyl)-3,4-dimethylpyrrole-2,5-dione?
1-(3-bromopropyl)-3,4-dimethylpyrrole-2,5-dione has a molecular weight of 246.10 g/mol, XLogP of 1.48, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-bromopropyl)-3,4-dimethylpyrrole-2,5-dione is sourced from PubChem (CID 146673829), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).