C28H46N13O5+ — CID 146674445
diaminomethylidene-[3-[1-[2-[4-[4-morpholin-4-yl-6-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethylamino]-1,3,5-triazin-2-yl]piperazin-1-yl]-2-oxoethyl]triazol-4-yl]propyl]azanium (PubChem CID 146674445) has the molecular formula C28H46N13O5+ and a molecular weight of 644.76 g/mol. Its IUPAC name is diaminomethylidene-[3-[1-[2-[4-[4-morpholin-4-yl-6-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethylamino]-1,3,5-triazin-2-yl]piperazin-1-yl]-2-oxoethyl]triazol-4-yl]propyl]azanium.
| Compound Name | diaminomethylidene-[3-[1-[2-[4-[4-morpholin-4-yl-6-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethylamino]-1,3,5-triazin-2-yl]piperazin-1-yl]-2-oxoethyl]triazol-4-yl]propyl]azanium |
|---|---|
| PubChem CID | 146674445 |
| Molecular Formula | C28H46N13O5+ |
| Molecular Weight | 644.76 g/mol |
| Exact Mass | 644.37 |
| IUPAC Name | diaminomethylidene-[3-[1-[2-[4-[4-morpholin-4-yl-6-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethylamino]-1,3,5-triazin-2-yl]piperazin-1-yl]-2-oxoethyl]triazol-4-yl]propyl]azanium |
| SMILES | C#CCOCCOCCOCCNc1nc(N2CCOCC2)nc(N2CCN(C(=O)Cn3cc(CCC[NH+]=C(N)N)nn3)CC2)n1 |
| InChI | InChI=1S/C28H45N13O5/c1-2-13-43-17-19-46-20-18-44-14-6-32-26-33-27(35-28(34-26)40-11-15-45-16-12-40)39-9-7-38(8-10-39)24(42)22-41-21-23(36-37-41)4-3-5-31-25(29)30/h1,21H,3-20,22H2,(H4,29,30,31)(H,32,33,34,35)/p+1 |
| InChIKey | NMIUOIPSLPWFEO-UHFFFAOYSA-O |
| XLogP | -3.97 |
| TPSA | 211.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.76 |
| LogP ≤ 5 | -3.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|