About (NE)-N-(5-methyl-2,3-dihydro-1,5-benzothiazepin-4-ylidene)hydroxylamine
(NE)-N-(5-methyl-2,3-dihydro-1,5-benzothiazepin-4-ylidene)hydroxylamine (PubChem CID 14667451) has the molecular formula C10H12N2OS
and a molecular weight of 208.29 g/mol. Its IUPAC name is (NE)-N-(5-methyl-2,3-dihydro-1,5-benzothiazepin-4-ylidene)hydroxylamine.
Molecular Properties
| Compound Name | (NE)-N-(5-methyl-2,3-dihydro-1,5-benzothiazepin-4-ylidene)hydroxylamine |
| PubChem CID | 14667451 |
| Molecular Formula | C10H12N2OS |
| Molecular Weight | 208.29 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | (NE)-N-(5-methyl-2,3-dihydro-1,5-benzothiazepin-4-ylidene)hydroxylamine |
| SMILES | CN1/C(=N/O)CCSc2ccccc21 |
| InChI | InChI=1S/C10H12N2OS/c1-12-8-4-2-3-5-9(8)14-7-6-10(12)11-13/h2-5,13H,6-7H2,1H3/b11-10+ |
| InChIKey | PYZMRMQWMBWPDE-ZHACJKMWSA-N |
| XLogP | 2.41 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.29 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (NE)-N-(5-methyl-2,3-dihydro-1,5-benzothiazepin-4-ylidene)hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (NE)-N-(5-methyl-2,3-dihydro-1,5-benzothiazepin-4-ylidene)hydroxylamine?
The IUPAC name of (NE)-N-(5-methyl-2,3-dihydro-1,5-benzothiazepin-4-ylidene)hydroxylamine (CID 14667451) is (NE)-N-(5-methyl-2,3-dihydro-1,5-benzothiazepin-4-ylidene)hydroxylamine.
What is the SMILES notation for (NE)-N-(5-methyl-2,3-dihydro-1,5-benzothiazepin-4-ylidene)hydroxylamine?
The canonical SMILES for (NE)-N-(5-methyl-2,3-dihydro-1,5-benzothiazepin-4-ylidene)hydroxylamine is CN1/C(=N/O)CCSc2ccccc21.
What is the InChIKey of (NE)-N-(5-methyl-2,3-dihydro-1,5-benzothiazepin-4-ylidene)hydroxylamine?
The InChIKey is PYZMRMQWMBWPDE-ZHACJKMWSA-N. The full InChI is InChI=1S/C10H12N2OS/c1-12-8-4-2-3-5-9(8)14-7-6-10(12)11-13/h2-5,13H,6-7H2,1H3/b11-10+.
What are the key properties of (NE)-N-(5-methyl-2,3-dihydro-1,5-benzothiazepin-4-ylidene)hydroxylamine?
(NE)-N-(5-methyl-2,3-dihydro-1,5-benzothiazepin-4-ylidene)hydroxylamine has a molecular weight of 208.29 g/mol, XLogP of 2.41, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (NE)-N-(5-methyl-2,3-dihydro-1,5-benzothiazepin-4-ylidene)hydroxylamine is sourced from PubChem (CID 14667451), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).