C21H28N2O2 — CID 146674971
ethyl 2-methyl-4-phenyl-1-propan-2-yl-6-propan-2-yliminopyridine-3-carboxylate (PubChem CID 146674971) has the molecular formula C21H28N2O2 and a molecular weight of 340.47 g/mol. Its IUPAC name is ethyl 2-methyl-4-phenyl-1-propan-2-yl-6-propan-2-yliminopyridine-3-carboxylate.
| Compound Name | ethyl 2-methyl-4-phenyl-1-propan-2-yl-6-propan-2-yliminopyridine-3-carboxylate |
|---|---|
| PubChem CID | 146674971 |
| Molecular Formula | C21H28N2O2 |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.22 |
| IUPAC Name | ethyl 2-methyl-4-phenyl-1-propan-2-yl-6-propan-2-yliminopyridine-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccccc2)c/c(=N\C(C)C)n(C(C)C)c1C |
| InChI | InChI=1S/C21H28N2O2/c1-7-25-21(24)20-16(6)23(15(4)5)19(22-14(2)3)13-18(20)17-11-9-8-10-12-17/h8-15H,7H2,1-6H3/b22-19+ |
| InChIKey | GYMBBLICUXWSBA-ZBJSNUHESA-N |
| XLogP | 4.53 |
| TPSA | 43.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |