About 10-(hydroxymethyl)-4-methyl-4-azatricyclo[5.2.2.02,6]undecane-8,9-diol
10-(hydroxymethyl)-4-methyl-4-azatricyclo[5.2.2.02,6]undecane-8,9-diol (PubChem CID 146675348) has the molecular formula C12H21NO3
and a molecular weight of 227.30 g/mol. Its IUPAC name is 10-(hydroxymethyl)-4-methyl-4-azatricyclo[5.2.2.02,6]undecane-8,9-diol.
Molecular Properties
| Compound Name | 10-(hydroxymethyl)-4-methyl-4-azatricyclo[5.2.2.02,6]undecane-8,9-diol |
| PubChem CID | 146675348 |
| Molecular Formula | C12H21NO3 |
| Molecular Weight | 227.30 g/mol |
| Exact Mass | 227.15 |
| IUPAC Name | 10-(hydroxymethyl)-4-methyl-4-azatricyclo[5.2.2.02,6]undecane-8,9-diol |
| SMILES | CN1CC2C3CC(CO)C(C(O)C3O)C2C1 |
| InChI | InChI=1S/C12H21NO3/c1-13-3-8-7-2-6(5-14)10(9(8)4-13)12(16)11(7)15/h6-12,14-16H,2-5H2,1H3 |
| InChIKey | JJUMEFUAQUJLHA-UHFFFAOYSA-N |
| XLogP | -0.86 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.30 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 10-(hydroxymethyl)-4-methyl-4-azatricyclo[5.2.2.02,6]undecane-8,9-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-(hydroxymethyl)-4-methyl-4-azatricyclo[5.2.2.02,6]undecane-8,9-diol?
The IUPAC name of 10-(hydroxymethyl)-4-methyl-4-azatricyclo[5.2.2.02,6]undecane-8,9-diol (CID 146675348) is 10-(hydroxymethyl)-4-methyl-4-azatricyclo[5.2.2.02,6]undecane-8,9-diol.
What is the SMILES notation for 10-(hydroxymethyl)-4-methyl-4-azatricyclo[5.2.2.02,6]undecane-8,9-diol?
The canonical SMILES for 10-(hydroxymethyl)-4-methyl-4-azatricyclo[5.2.2.02,6]undecane-8,9-diol is CN1CC2C3CC(CO)C(C(O)C3O)C2C1.
What is the InChIKey of 10-(hydroxymethyl)-4-methyl-4-azatricyclo[5.2.2.02,6]undecane-8,9-diol?
The InChIKey is JJUMEFUAQUJLHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21NO3/c1-13-3-8-7-2-6(5-14)10(9(8)4-13)12(16)11(7)15/h6-12,14-16H,2-5H2,1H3.
What are the key properties of 10-(hydroxymethyl)-4-methyl-4-azatricyclo[5.2.2.02,6]undecane-8,9-diol?
10-(hydroxymethyl)-4-methyl-4-azatricyclo[5.2.2.02,6]undecane-8,9-diol has a molecular weight of 227.30 g/mol, XLogP of -0.86, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 10-(hydroxymethyl)-4-methyl-4-azatricyclo[5.2.2.02,6]undecane-8,9-diol is sourced from PubChem (CID 146675348), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).