About 3-oxa-1,7-diazaspiro[4.4]nonan-2-one;hydrochloride
3-oxa-1,7-diazaspiro[4.4]nonan-2-one;hydrochloride (PubChem CID 146675782) has the molecular formula C6H11ClN2O2
and a molecular weight of 178.62 g/mol. Its IUPAC name is 3-oxa-1,7-diazaspiro[4.4]nonan-2-one;hydrochloride.
Molecular Properties
| Compound Name | 3-oxa-1,7-diazaspiro[4.4]nonan-2-one;hydrochloride |
| PubChem CID | 146675782 |
| Molecular Formula | C6H11ClN2O2 |
| Molecular Weight | 178.62 g/mol |
| Exact Mass | 178.05 |
| IUPAC Name | 3-oxa-1,7-diazaspiro[4.4]nonan-2-one;hydrochloride |
| SMILES | Cl.O=C1NC2(CCNC2)CO1 |
| InChI | InChI=1S/C6H10N2O2.ClH/c9-5-8-6(4-10-5)1-2-7-3-6;/h7H,1-4H2,(H,8,9);1H |
| InChIKey | QDRJKYGXBLQKLB-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.62 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-oxa-1,7-diazaspiro[4.4]nonan-2-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-oxa-1,7-diazaspiro[4.4]nonan-2-one;hydrochloride?
The IUPAC name of 3-oxa-1,7-diazaspiro[4.4]nonan-2-one;hydrochloride (CID 146675782) is 3-oxa-1,7-diazaspiro[4.4]nonan-2-one;hydrochloride.
What is the SMILES notation for 3-oxa-1,7-diazaspiro[4.4]nonan-2-one;hydrochloride?
The canonical SMILES for 3-oxa-1,7-diazaspiro[4.4]nonan-2-one;hydrochloride is Cl.O=C1NC2(CCNC2)CO1.
What is the InChIKey of 3-oxa-1,7-diazaspiro[4.4]nonan-2-one;hydrochloride?
The InChIKey is QDRJKYGXBLQKLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2O2.ClH/c9-5-8-6(4-10-5)1-2-7-3-6;/h7H,1-4H2,(H,8,9);1H.
What are the key properties of 3-oxa-1,7-diazaspiro[4.4]nonan-2-one;hydrochloride?
3-oxa-1,7-diazaspiro[4.4]nonan-2-one;hydrochloride has a molecular weight of 178.62 g/mol, XLogP of -0.12, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-oxa-1,7-diazaspiro[4.4]nonan-2-one;hydrochloride is sourced from PubChem (CID 146675782), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).