C27H26F2N6O2 — CID 146676589
1-[3-[4-(4-aminopiperidin-1-yl)-3-(3,5-difluorophenyl)quinolin-6-yl]-2-pyridinyl]-3-methoxyurea (PubChem CID 146676589) has the molecular formula C27H26F2N6O2 and a molecular weight of 504.54 g/mol. Its IUPAC name is 1-[3-[4-(4-aminopiperidin-1-yl)-3-(3,5-difluorophenyl)quinolin-6-yl]-2-pyridinyl]-3-methoxyurea.
| Compound Name | 1-[3-[4-(4-aminopiperidin-1-yl)-3-(3,5-difluorophenyl)quinolin-6-yl]-2-pyridinyl]-3-methoxyurea |
|---|---|
| PubChem CID | 146676589 |
| Molecular Formula | C27H26F2N6O2 |
| Molecular Weight | 504.54 g/mol |
| Exact Mass | 504.21 |
| IUPAC Name | 1-[3-[4-(4-aminopiperidin-1-yl)-3-(3,5-difluorophenyl)quinolin-6-yl]-2-pyridinyl]-3-methoxyurea |
| SMILES | CONC(=O)Nc1ncccc1-c1ccc2ncc(-c3cc(F)cc(F)c3)c(N3CCC(N)CC3)c2c1 |
| InChI | InChI=1S/C27H26F2N6O2/c1-37-34-27(36)33-26-21(3-2-8-31-26)16-4-5-24-22(13-16)25(35-9-6-20(30)7-10-35)23(15-32-24)17-11-18(28)14-19(29)12-17/h2-5,8,11-15,20H,6-7,9-10,30H2,1H3,(H2,31,33,34,36) |
| InChIKey | FHPCZZCAZHBCKM-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 105.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.54 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|