C29H27FN6O — CID 146676595
5-[4-[(4aR,8aR)-2,3,4,4a,5,7,8,8a-octahydropyrido[4,3-b][1,4]oxazin-6-yl]-3-(3-fluoro-5-methylphenyl)quinolin-6-yl]-4-aminopyridine-3-carbonitrile (PubChem CID 146676595) has the molecular formula C29H27FN6O and a molecular weight of 494.57 g/mol. Its IUPAC name is 5-[4-[(4aR,8aR)-2,3,4,4a,5,7,8,8a-octahydropyrido[4,3-b][1,4]oxazin-6-yl]-3-(3-fluoro-5-methylphenyl)quinolin-6-yl]-4-aminopyridine-3-carbonitrile.
| Compound Name | 5-[4-[(4aR,8aR)-2,3,4,4a,5,7,8,8a-octahydropyrido[4,3-b][1,4]oxazin-6-yl]-3-(3-fluoro-5-methylphenyl)quinolin-6-yl]-4-aminopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 146676595 |
| Molecular Formula | C29H27FN6O |
| Molecular Weight | 494.57 g/mol |
| Exact Mass | 494.22 |
| IUPAC Name | 5-[4-[(4aR,8aR)-2,3,4,4a,5,7,8,8a-octahydropyrido[4,3-b][1,4]oxazin-6-yl]-3-(3-fluoro-5-methylphenyl)quinolin-6-yl]-4-aminopyridine-3-carbonitrile |
| SMILES | Cc1cc(F)cc(-c2cnc3ccc(-c4cncc(C#N)c4N)cc3c2N2CC[C@H]3OCCN[C@@H]3C2)c1 |
| InChI | InChI=1S/C29H27FN6O/c1-17-8-19(10-21(30)9-17)24-15-35-25-3-2-18(23-14-33-13-20(12-31)28(23)32)11-22(25)29(24)36-6-4-27-26(16-36)34-5-7-37-27/h2-3,8-11,13-15,26-27,34H,4-7,16H2,1H3,(H2,32,33)/t26-,27-/m1/s1 |
| InChIKey | USKZBYYSKPCELP-KAYWLYCHSA-N |
| XLogP | 4.43 |
| TPSA | 100.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.57 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |