C27H29FN6O — CID 146676600
3-[4-[(4aR,8aR)-2,3,4,4a,5,7,8,8a-octahydropyrido[4,3-b][1,4]oxazin-6-yl]-3-(3-fluoro-5-methylphenyl)quinolin-6-yl]-1-methylpyrazol-4-amine (PubChem CID 146676600) has the molecular formula C27H29FN6O and a molecular weight of 472.57 g/mol. Its IUPAC name is 3-[4-[(4aR,8aR)-2,3,4,4a,5,7,8,8a-octahydropyrido[4,3-b][1,4]oxazin-6-yl]-3-(3-fluoro-5-methylphenyl)quinolin-6-yl]-1-methylpyrazol-4-amine.
| Compound Name | 3-[4-[(4aR,8aR)-2,3,4,4a,5,7,8,8a-octahydropyrido[4,3-b][1,4]oxazin-6-yl]-3-(3-fluoro-5-methylphenyl)quinolin-6-yl]-1-methylpyrazol-4-amine |
|---|---|
| PubChem CID | 146676600 |
| Molecular Formula | C27H29FN6O |
| Molecular Weight | 472.57 g/mol |
| Exact Mass | 472.24 |
| IUPAC Name | 3-[4-[(4aR,8aR)-2,3,4,4a,5,7,8,8a-octahydropyrido[4,3-b][1,4]oxazin-6-yl]-3-(3-fluoro-5-methylphenyl)quinolin-6-yl]-1-methylpyrazol-4-amine |
| SMILES | Cc1cc(F)cc(-c2cnc3ccc(-c4nn(C)cc4N)cc3c2N2CC[C@H]3OCCN[C@@H]3C2)c1 |
| InChI | InChI=1S/C27H29FN6O/c1-16-9-18(11-19(28)10-16)21-13-31-23-4-3-17(26-22(29)14-33(2)32-26)12-20(23)27(21)34-7-5-25-24(15-34)30-6-8-35-25/h3-4,9-14,24-25,30H,5-8,15,29H2,1-2H3/t24-,25-/m1/s1 |
| InChIKey | OPSOUKIBXFBHKL-JWQCQUIFSA-N |
| XLogP | 3.90 |
| TPSA | 81.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.57 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |