C29H28FN5O2 — CID 146676614
(NZ)-N-[[6-[4-[(4aR,8aR)-2,3,4,4a,5,7,8,8a-octahydropyrido[4,3-b][1,4]oxazin-6-yl]-3-(3-fluoro-5-methylphenyl)quinolin-6-yl]-2-pyridinyl]methylidene]hydroxylamine (PubChem CID 146676614) has the molecular formula C29H28FN5O2 and a molecular weight of 497.57 g/mol. Its IUPAC name is (NZ)-N-[[6-[4-[(4aR,8aR)-2,3,4,4a,5,7,8,8a-octahydropyrido[4,3-b][1,4]oxazin-6-yl]-3-(3-fluoro-5-methylphenyl)quinolin-6-yl]-2-pyridinyl]methylidene]hydroxylamine.
| Compound Name | (NZ)-N-[[6-[4-[(4aR,8aR)-2,3,4,4a,5,7,8,8a-octahydropyrido[4,3-b][1,4]oxazin-6-yl]-3-(3-fluoro-5-methylphenyl)quinolin-6-yl]-2-pyridinyl]methylidene]hydroxylamine |
|---|---|
| PubChem CID | 146676614 |
| Molecular Formula | C29H28FN5O2 |
| Molecular Weight | 497.57 g/mol |
| Exact Mass | 497.22 |
| IUPAC Name | (NZ)-N-[[6-[4-[(4aR,8aR)-2,3,4,4a,5,7,8,8a-octahydropyrido[4,3-b][1,4]oxazin-6-yl]-3-(3-fluoro-5-methylphenyl)quinolin-6-yl]-2-pyridinyl]methylidene]hydroxylamine |
| SMILES | Cc1cc(F)cc(-c2cnc3ccc(-c4cccc(/C=N\O)n4)cc3c2N2CC[C@H]3OCCN[C@@H]3C2)c1 |
| InChI | InChI=1S/C29H28FN5O2/c1-18-11-20(13-21(30)12-18)24-16-32-26-6-5-19(25-4-2-3-22(34-25)15-33-36)14-23(26)29(24)35-9-7-28-27(17-35)31-8-10-37-28/h2-6,11-16,27-28,31,36H,7-10,17H2,1H3/b33-15-/t27-,28-/m1/s1 |
| InChIKey | IWPCXRPLDPBLBP-PBRPMACISA-N |
| XLogP | 4.79 |
| TPSA | 82.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.57 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|