C31H33FN6O2 — CID 146676616
3-[4-[(4aR,8aR)-2,3,4,4a,5,7,8,8a-octahydropyrido[4,3-b][1,4]oxazin-6-yl]-3-(3-fluoro-5-methylphenyl)quinolin-6-yl]-5-[(2E)-2-methoxyiminoethyl]pyridin-4-amine (PubChem CID 146676616) has the molecular formula C31H33FN6O2 and a molecular weight of 540.64 g/mol. Its IUPAC name is 3-[4-[(4aR,8aR)-2,3,4,4a,5,7,8,8a-octahydropyrido[4,3-b][1,4]oxazin-6-yl]-3-(3-fluoro-5-methylphenyl)quinolin-6-yl]-5-[(2E)-2-methoxyiminoethyl]pyridin-4-amine.
| Compound Name | 3-[4-[(4aR,8aR)-2,3,4,4a,5,7,8,8a-octahydropyrido[4,3-b][1,4]oxazin-6-yl]-3-(3-fluoro-5-methylphenyl)quinolin-6-yl]-5-[(2E)-2-methoxyiminoethyl]pyridin-4-amine |
|---|---|
| PubChem CID | 146676616 |
| Molecular Formula | C31H33FN6O2 |
| Molecular Weight | 540.64 g/mol |
| Exact Mass | 540.26 |
| IUPAC Name | 3-[4-[(4aR,8aR)-2,3,4,4a,5,7,8,8a-octahydropyrido[4,3-b][1,4]oxazin-6-yl]-3-(3-fluoro-5-methylphenyl)quinolin-6-yl]-5-[(2E)-2-methoxyiminoethyl]pyridin-4-amine |
| SMILES | CO/N=C/Cc1cncc(-c2ccc3ncc(-c4cc(C)cc(F)c4)c(N4CC[C@H]5OCCN[C@@H]5C4)c3c2)c1N |
| InChI | InChI=1S/C31H33FN6O2/c1-19-11-22(13-23(32)12-19)26-17-36-27-4-3-20(25-16-34-15-21(30(25)33)5-7-37-39-2)14-24(27)31(26)38-9-6-29-28(18-38)35-8-10-40-29/h3-4,7,11-17,28-29,35H,5-6,8-10,18H2,1-2H3,(H2,33,34)/b37-7+/t28-,29-/m1/s1 |
| InChIKey | COTSUYQXBUSKAC-FPPGWVNFSA-N |
| XLogP | 4.74 |
| TPSA | 97.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.64 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|