C30H31FN6O2 — CID 146676619
2-[4-[(4aR,8aR)-2,3,4,4a,5,7,8,8a-octahydropyrido[4,3-b][1,4]oxazin-6-yl]-3-(3-fluoro-5-methylphenyl)quinolin-6-yl]-4-[(Z)-methoxyiminomethyl]pyridin-3-amine (PubChem CID 146676619) has the molecular formula C30H31FN6O2 and a molecular weight of 526.62 g/mol. Its IUPAC name is 2-[4-[(4aR,8aR)-2,3,4,4a,5,7,8,8a-octahydropyrido[4,3-b][1,4]oxazin-6-yl]-3-(3-fluoro-5-methylphenyl)quinolin-6-yl]-4-[(Z)-methoxyiminomethyl]pyridin-3-amine.
| Compound Name | 2-[4-[(4aR,8aR)-2,3,4,4a,5,7,8,8a-octahydropyrido[4,3-b][1,4]oxazin-6-yl]-3-(3-fluoro-5-methylphenyl)quinolin-6-yl]-4-[(Z)-methoxyiminomethyl]pyridin-3-amine |
|---|---|
| PubChem CID | 146676619 |
| Molecular Formula | C30H31FN6O2 |
| Molecular Weight | 526.62 g/mol |
| Exact Mass | 526.25 |
| IUPAC Name | 2-[4-[(4aR,8aR)-2,3,4,4a,5,7,8,8a-octahydropyrido[4,3-b][1,4]oxazin-6-yl]-3-(3-fluoro-5-methylphenyl)quinolin-6-yl]-4-[(Z)-methoxyiminomethyl]pyridin-3-amine |
| SMILES | CO/N=C\c1ccnc(-c2ccc3ncc(-c4cc(C)cc(F)c4)c(N4CC[C@H]5OCCN[C@@H]5C4)c3c2)c1N |
| InChI | InChI=1S/C30H31FN6O2/c1-18-11-21(13-22(31)12-18)24-16-35-25-4-3-19(29-28(32)20(5-7-34-29)15-36-38-2)14-23(25)30(24)37-9-6-27-26(17-37)33-8-10-39-27/h3-5,7,11-16,26-27,33H,6,8-10,17,32H2,1-2H3/b36-15-/t26-,27-/m1/s1 |
| InChIKey | NJORHYRIVCMPBE-QUWONLRASA-N |
| XLogP | 4.54 |
| TPSA | 97.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.62 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|