C29H28F2N6O3 — CID 146676621
1-[3-[4-[(4aR,8aR)-2,3,4,4a,5,7,8,8a-octahydropyrido[4,3-b][1,4]oxazin-6-yl]-3-(3,5-difluorophenyl)quinolin-6-yl]-2-pyridinyl]-3-methoxyurea (PubChem CID 146676621) has the molecular formula C29H28F2N6O3 and a molecular weight of 546.58 g/mol. Its IUPAC name is 1-[3-[4-[(4aR,8aR)-2,3,4,4a,5,7,8,8a-octahydropyrido[4,3-b][1,4]oxazin-6-yl]-3-(3,5-difluorophenyl)quinolin-6-yl]-2-pyridinyl]-3-methoxyurea.
| Compound Name | 1-[3-[4-[(4aR,8aR)-2,3,4,4a,5,7,8,8a-octahydropyrido[4,3-b][1,4]oxazin-6-yl]-3-(3,5-difluorophenyl)quinolin-6-yl]-2-pyridinyl]-3-methoxyurea |
|---|---|
| PubChem CID | 146676621 |
| Molecular Formula | C29H28F2N6O3 |
| Molecular Weight | 546.58 g/mol |
| Exact Mass | 546.22 |
| IUPAC Name | 1-[3-[4-[(4aR,8aR)-2,3,4,4a,5,7,8,8a-octahydropyrido[4,3-b][1,4]oxazin-6-yl]-3-(3,5-difluorophenyl)quinolin-6-yl]-2-pyridinyl]-3-methoxyurea |
| SMILES | CONC(=O)Nc1ncccc1-c1ccc2ncc(-c3cc(F)cc(F)c3)c(N3CC[C@H]4OCCN[C@@H]4C3)c2c1 |
| InChI | InChI=1S/C29H28F2N6O3/c1-39-36-29(38)35-28-21(3-2-7-33-28)17-4-5-24-22(13-17)27(37-9-6-26-25(16-37)32-8-10-40-26)23(15-34-24)18-11-19(30)14-20(31)12-18/h2-5,7,11-15,25-26,32H,6,8-10,16H2,1H3,(H2,33,35,36,38)/t25-,26-/m1/s1 |
| InChIKey | OAYGEANMEZYAPF-CLJLJLNGSA-N |
| XLogP | 4.49 |
| TPSA | 100.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.58 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|