C28H28FN5O — CID 146676626
2-[4-[(4aR,8aR)-2,3,4,4a,5,7,8,8a-octahydropyrido[4,3-b][1,4]oxazin-6-yl]-3-(3-fluoro-5-methylphenyl)quinolin-6-yl]pyridin-3-amine (PubChem CID 146676626) has the molecular formula C28H28FN5O and a molecular weight of 469.56 g/mol. Its IUPAC name is 2-[4-[(4aR,8aR)-2,3,4,4a,5,7,8,8a-octahydropyrido[4,3-b][1,4]oxazin-6-yl]-3-(3-fluoro-5-methylphenyl)quinolin-6-yl]pyridin-3-amine.
| Compound Name | 2-[4-[(4aR,8aR)-2,3,4,4a,5,7,8,8a-octahydropyrido[4,3-b][1,4]oxazin-6-yl]-3-(3-fluoro-5-methylphenyl)quinolin-6-yl]pyridin-3-amine |
|---|---|
| PubChem CID | 146676626 |
| Molecular Formula | C28H28FN5O |
| Molecular Weight | 469.56 g/mol |
| Exact Mass | 469.23 |
| IUPAC Name | 2-[4-[(4aR,8aR)-2,3,4,4a,5,7,8,8a-octahydropyrido[4,3-b][1,4]oxazin-6-yl]-3-(3-fluoro-5-methylphenyl)quinolin-6-yl]pyridin-3-amine |
| SMILES | Cc1cc(F)cc(-c2cnc3ccc(-c4ncccc4N)cc3c2N2CC[C@H]3OCCN[C@@H]3C2)c1 |
| InChI | InChI=1S/C28H28FN5O/c1-17-11-19(13-20(29)12-17)22-15-33-24-5-4-18(27-23(30)3-2-7-32-27)14-21(24)28(22)34-9-6-26-25(16-34)31-8-10-35-26/h2-5,7,11-15,25-26,31H,6,8-10,16,30H2,1H3/t25-,26-/m1/s1 |
| InChIKey | GNEDWBVZRMUHOG-CLJLJLNGSA-N |
| XLogP | 4.56 |
| TPSA | 76.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.56 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |