About 2-fluoro-8-[(6-iodo-1,3-benzodioxol-5-yl)methyl]-9-(3-morpholin-4-ylpropyl)purin-6-amine
2-fluoro-8-[(6-iodo-1,3-benzodioxol-5-yl)methyl]-9-(3-morpholin-4-ylpropyl)purin-6-amine (PubChem CID 146676695) has the molecular formula C20H22FIN6O3
and a molecular weight of 540.34 g/mol. Its IUPAC name is 2-fluoro-8-[(6-iodo-1,3-benzodioxol-5-yl)methyl]-9-(3-morpholin-4-ylpropyl)purin-6-amine.
Molecular Properties
| Compound Name | 2-fluoro-8-[(6-iodo-1,3-benzodioxol-5-yl)methyl]-9-(3-morpholin-4-ylpropyl)purin-6-amine |
| PubChem CID | 146676695 |
| Molecular Formula | C20H22FIN6O3 |
| Molecular Weight | 540.34 g/mol |
| Exact Mass | 540.08 |
| IUPAC Name | 2-fluoro-8-[(6-iodo-1,3-benzodioxol-5-yl)methyl]-9-(3-morpholin-4-ylpropyl)purin-6-amine |
| SMILES | Nc1nc(F)nc2c1nc(Cc1cc3c(cc1I)OCO3)n2CCCN1CCOCC1 |
| InChI | InChI=1S/C20H22FIN6O3/c21-20-25-18(23)17-19(26-20)28(3-1-2-27-4-6-29-7-5-27)16(24-17)9-12-8-14-15(10-13(12)22)31-11-30-14/h8,10H,1-7,9,11H2,(H2,23,25,26) |
| InChIKey | CMRAENCUOOKXQN-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 100.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 540.34 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoro-8-[(6-iodo-1,3-benzodioxol-5-yl)methyl]-9-(3-morpholin-4-ylpropyl)purin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-8-[(6-iodo-1,3-benzodioxol-5-yl)methyl]-9-(3-morpholin-4-ylpropyl)purin-6-amine?
The IUPAC name of 2-fluoro-8-[(6-iodo-1,3-benzodioxol-5-yl)methyl]-9-(3-morpholin-4-ylpropyl)purin-6-amine (CID 146676695) is 2-fluoro-8-[(6-iodo-1,3-benzodioxol-5-yl)methyl]-9-(3-morpholin-4-ylpropyl)purin-6-amine.
What is the SMILES notation for 2-fluoro-8-[(6-iodo-1,3-benzodioxol-5-yl)methyl]-9-(3-morpholin-4-ylpropyl)purin-6-amine?
The canonical SMILES for 2-fluoro-8-[(6-iodo-1,3-benzodioxol-5-yl)methyl]-9-(3-morpholin-4-ylpropyl)purin-6-amine is Nc1nc(F)nc2c1nc(Cc1cc3c(cc1I)OCO3)n2CCCN1CCOCC1.
What is the InChIKey of 2-fluoro-8-[(6-iodo-1,3-benzodioxol-5-yl)methyl]-9-(3-morpholin-4-ylpropyl)purin-6-amine?
The InChIKey is CMRAENCUOOKXQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22FIN6O3/c21-20-25-18(23)17-19(26-20)28(3-1-2-27-4-6-29-7-5-27)16(24-17)9-12-8-14-15(10-13(12)22)31-11-30-14/h8,10H,1-7,9,11H2,(H2,23,25,26).
What are the key properties of 2-fluoro-8-[(6-iodo-1,3-benzodioxol-5-yl)methyl]-9-(3-morpholin-4-ylpropyl)purin-6-amine?
2-fluoro-8-[(6-iodo-1,3-benzodioxol-5-yl)methyl]-9-(3-morpholin-4-ylpropyl)purin-6-amine has a molecular weight of 540.34 g/mol, XLogP of 2.19, 6 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-8-[(6-iodo-1,3-benzodioxol-5-yl)methyl]-9-(3-morpholin-4-ylpropyl)purin-6-amine is sourced from PubChem (CID 146676695), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).