C12H21NO6 — CID 146676893
N-[(1S,2R,3R,4R,5R)-2,3-dihydroxy-1-(propoxymethyl)-6,8-dioxabicyclo[3.2.1]octan-4-yl]acetamide (PubChem CID 146676893) has the molecular formula C12H21NO6 and a molecular weight of 275.30 g/mol. Its IUPAC name is N-[(1S,2R,3R,4R,5R)-2,3-dihydroxy-1-(propoxymethyl)-6,8-dioxabicyclo[3.2.1]octan-4-yl]acetamide.
| Compound Name | N-[(1S,2R,3R,4R,5R)-2,3-dihydroxy-1-(propoxymethyl)-6,8-dioxabicyclo[3.2.1]octan-4-yl]acetamide |
|---|---|
| PubChem CID | 146676893 |
| Molecular Formula | C12H21NO6 |
| Molecular Weight | 275.30 g/mol |
| Exact Mass | 275.14 |
| IUPAC Name | N-[(1S,2R,3R,4R,5R)-2,3-dihydroxy-1-(propoxymethyl)-6,8-dioxabicyclo[3.2.1]octan-4-yl]acetamide |
| SMILES | CCCOC[C@@]12CO[C@H](O1)[C@H](NC(C)=O)[C@@H](O)[C@H]2O |
| InChI | InChI=1S/C12H21NO6/c1-3-4-17-5-12-6-18-11(19-12)8(13-7(2)14)9(15)10(12)16/h8-11,15-16H,3-6H2,1-2H3,(H,13,14)/t8-,9-,10-,11-,12+/m1/s1 |
| InChIKey | MCRXWZGKIYKWFC-OOCWMUITSA-N |
| XLogP | -1.24 |
| TPSA | 97.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.30 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|