C14H25NO6 — CID 146676895
N-[(1S,2R,3R,4R,5R)-2,3-dihydroxy-1-(pentoxymethyl)-6,8-dioxabicyclo[3.2.1]octan-4-yl]acetamide (PubChem CID 146676895) has the molecular formula C14H25NO6 and a molecular weight of 303.36 g/mol. Its IUPAC name is N-[(1S,2R,3R,4R,5R)-2,3-dihydroxy-1-(pentoxymethyl)-6,8-dioxabicyclo[3.2.1]octan-4-yl]acetamide.
| Compound Name | N-[(1S,2R,3R,4R,5R)-2,3-dihydroxy-1-(pentoxymethyl)-6,8-dioxabicyclo[3.2.1]octan-4-yl]acetamide |
|---|---|
| PubChem CID | 146676895 |
| Molecular Formula | C14H25NO6 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.17 |
| IUPAC Name | N-[(1S,2R,3R,4R,5R)-2,3-dihydroxy-1-(pentoxymethyl)-6,8-dioxabicyclo[3.2.1]octan-4-yl]acetamide |
| SMILES | CCCCCOC[C@@]12CO[C@H](O1)[C@H](NC(C)=O)[C@@H](O)[C@H]2O |
| InChI | InChI=1S/C14H25NO6/c1-3-4-5-6-19-7-14-8-20-13(21-14)10(15-9(2)16)11(17)12(14)18/h10-13,17-18H,3-8H2,1-2H3,(H,15,16)/t10-,11-,12-,13-,14+/m1/s1 |
| InChIKey | QZTUXGYJAGWYNA-KSTCHIGDSA-N |
| XLogP | -0.46 |
| TPSA | 97.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|