C13H23NO6 — CID 146676896
N-[(1S,2R,3R,4R,5R)-1-(butoxymethyl)-2,3-dihydroxy-6,8-dioxabicyclo[3.2.1]octan-4-yl]acetamide (PubChem CID 146676896) has the molecular formula C13H23NO6 and a molecular weight of 289.33 g/mol. Its IUPAC name is N-[(1S,2R,3R,4R,5R)-1-(butoxymethyl)-2,3-dihydroxy-6,8-dioxabicyclo[3.2.1]octan-4-yl]acetamide.
| Compound Name | N-[(1S,2R,3R,4R,5R)-1-(butoxymethyl)-2,3-dihydroxy-6,8-dioxabicyclo[3.2.1]octan-4-yl]acetamide |
|---|---|
| PubChem CID | 146676896 |
| Molecular Formula | C13H23NO6 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.15 |
| IUPAC Name | N-[(1S,2R,3R,4R,5R)-1-(butoxymethyl)-2,3-dihydroxy-6,8-dioxabicyclo[3.2.1]octan-4-yl]acetamide |
| SMILES | CCCCOC[C@@]12CO[C@H](O1)[C@H](NC(C)=O)[C@@H](O)[C@H]2O |
| InChI | InChI=1S/C13H23NO6/c1-3-4-5-18-6-13-7-19-12(20-13)9(14-8(2)15)10(16)11(13)17/h9-12,16-17H,3-7H2,1-2H3,(H,14,15)/t9-,10-,11-,12-,13+/m1/s1 |
| InChIKey | PGKJQKYHFYHTNB-VEGXAWMVSA-N |
| XLogP | -0.85 |
| TPSA | 97.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|