C15H27NO6 — CID 146676897
N-[(1S,2R,3R,4R,5R)-1-(hexoxymethyl)-2,3-dihydroxy-6,8-dioxabicyclo[3.2.1]octan-4-yl]acetamide (PubChem CID 146676897) has the molecular formula C15H27NO6 and a molecular weight of 317.38 g/mol. Its IUPAC name is N-[(1S,2R,3R,4R,5R)-1-(hexoxymethyl)-2,3-dihydroxy-6,8-dioxabicyclo[3.2.1]octan-4-yl]acetamide.
| Compound Name | N-[(1S,2R,3R,4R,5R)-1-(hexoxymethyl)-2,3-dihydroxy-6,8-dioxabicyclo[3.2.1]octan-4-yl]acetamide |
|---|---|
| PubChem CID | 146676897 |
| Molecular Formula | C15H27NO6 |
| Molecular Weight | 317.38 g/mol |
| Exact Mass | 317.18 |
| IUPAC Name | N-[(1S,2R,3R,4R,5R)-1-(hexoxymethyl)-2,3-dihydroxy-6,8-dioxabicyclo[3.2.1]octan-4-yl]acetamide |
| SMILES | CCCCCCOC[C@@]12CO[C@H](O1)[C@H](NC(C)=O)[C@@H](O)[C@H]2O |
| InChI | InChI=1S/C15H27NO6/c1-3-4-5-6-7-20-8-15-9-21-14(22-15)11(16-10(2)17)12(18)13(15)19/h11-14,18-19H,3-9H2,1-2H3,(H,16,17)/t11-,12-,13-,14-,15+/m1/s1 |
| InChIKey | IWWKUYXRZZEIJJ-RYPNDVFKSA-N |
| XLogP | -0.06 |
| TPSA | 97.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.38 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|