About 5,5-diethyl-3H-pyridine-4,6-dione
5,5-diethyl-3H-pyridine-4,6-dione (PubChem CID 146678801) has the molecular formula C9H13NO2
and a molecular weight of 167.21 g/mol. Its IUPAC name is 5,5-diethyl-3H-pyridine-4,6-dione.
Molecular Properties
| Compound Name | 5,5-diethyl-3H-pyridine-4,6-dione |
| PubChem CID | 146678801 |
| Molecular Formula | C9H13NO2 |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.09 |
| IUPAC Name | 5,5-diethyl-3H-pyridine-4,6-dione |
| SMILES | CCC1(CC)C(=O)CC=NC1=O |
| InChI | InChI=1S/C9H13NO2/c1-3-9(4-2)7(11)5-6-10-8(9)12/h6H,3-5H2,1-2H3 |
| InChIKey | PXOUWIIMEOTTMM-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 5,5-diethyl-3H-pyridine-4,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,5-diethyl-3H-pyridine-4,6-dione?
The IUPAC name of 5,5-diethyl-3H-pyridine-4,6-dione (CID 146678801) is 5,5-diethyl-3H-pyridine-4,6-dione.
What is the SMILES notation for 5,5-diethyl-3H-pyridine-4,6-dione?
The canonical SMILES for 5,5-diethyl-3H-pyridine-4,6-dione is CCC1(CC)C(=O)CC=NC1=O.
What is the InChIKey of 5,5-diethyl-3H-pyridine-4,6-dione?
The InChIKey is PXOUWIIMEOTTMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO2/c1-3-9(4-2)7(11)5-6-10-8(9)12/h6H,3-5H2,1-2H3.
What are the key properties of 5,5-diethyl-3H-pyridine-4,6-dione?
5,5-diethyl-3H-pyridine-4,6-dione has a molecular weight of 167.21 g/mol, XLogP of 1.36, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-diethyl-3H-pyridine-4,6-dione is sourced from PubChem (CID 146678801), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).