C18H22N4O4S — CID 146680869
5-methoxy-11-methyl-17-oxa-8λ6-thia-1,4,7,11-tetrazatetracyclo[11.6.2.12,6.016,20]docosa-2(22),3,5,13(21),14,16(20)-hexaene 8,8-dioxide (PubChem CID 146680869) has the molecular formula C18H22N4O4S and a molecular weight of 390.47 g/mol. Its IUPAC name is 5-methoxy-11-methyl-17-oxa-8λ6-thia-1,4,7,11-tetrazatetracyclo[11.6.2.12,6.016,20]docosa-2(22),3,5,13(21),14,16(20)-hexaene 8,8-dioxide.
| Compound Name | 5-methoxy-11-methyl-17-oxa-8λ6-thia-1,4,7,11-tetrazatetracyclo[11.6.2.12,6.016,20]docosa-2(22),3,5,13(21),14,16(20)-hexaene 8,8-dioxide |
|---|---|
| PubChem CID | 146680869 |
| Molecular Formula | C18H22N4O4S |
| Molecular Weight | 390.47 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | 5-methoxy-11-methyl-17-oxa-8λ6-thia-1,4,7,11-tetrazatetracyclo[11.6.2.12,6.016,20]docosa-2(22),3,5,13(21),14,16(20)-hexaene 8,8-dioxide |
| SMILES | COc1ncc2cc1NS(=O)(=O)CCN(C)Cc1ccc3c(c1)N2CCO3 |
| InChI | InChI=1S/C18H22N4O4S/c1-21-6-8-27(23,24)20-15-10-14(11-19-18(15)25-2)22-5-7-26-17-4-3-13(12-21)9-16(17)22/h3-4,9-11,20H,5-8,12H2,1-2H3 |
| InChIKey | GANNRSDWVBVNOE-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 84.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.47 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |