C26H21N7O4 — CID 146681054
N-[[1-[2-(2-methyl-3-nitroanilino)-2-oxoethyl]triazol-4-yl]methyl]acridine-9-carboxamide (PubChem CID 146681054) has the molecular formula C26H21N7O4 and a molecular weight of 495.50 g/mol. Its IUPAC name is N-[[1-[2-(2-methyl-3-nitroanilino)-2-oxoethyl]triazol-4-yl]methyl]acridine-9-carboxamide.
| Compound Name | N-[[1-[2-(2-methyl-3-nitroanilino)-2-oxoethyl]triazol-4-yl]methyl]acridine-9-carboxamide |
|---|---|
| PubChem CID | 146681054 |
| Molecular Formula | C26H21N7O4 |
| Molecular Weight | 495.50 g/mol |
| Exact Mass | 495.17 |
| IUPAC Name | N-[[1-[2-(2-methyl-3-nitroanilino)-2-oxoethyl]triazol-4-yl]methyl]acridine-9-carboxamide |
| SMILES | Cc1c(NC(=O)Cn2cc(CNC(=O)c3c4ccccc4nc4ccccc34)nn2)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C26H21N7O4/c1-16-20(11-6-12-23(16)33(36)37)29-24(34)15-32-14-17(30-31-32)13-27-26(35)25-18-7-2-4-9-21(18)28-22-10-5-3-8-19(22)25/h2-12,14H,13,15H2,1H3,(H,27,35)(H,29,34) |
| InChIKey | NZLOGNFTTURKJM-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 144.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.50 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|