C45H30N2O10 — CID 146681736
2-[5-[4-[[4-[2-(carboxymethyl)-1,3-dioxoisoindol-5-yl]oxyphenyl]-diphenylmethyl]phenoxy]-1,3-dioxoisoindol-2-yl]acetic acid (PubChem CID 146681736) has the molecular formula C45H30N2O10 and a molecular weight of 758.74 g/mol. Its IUPAC name is 2-[5-[4-[[4-[2-(carboxymethyl)-1,3-dioxoisoindol-5-yl]oxyphenyl]-diphenylmethyl]phenoxy]-1,3-dioxoisoindol-2-yl]acetic acid.
| Compound Name | 2-[5-[4-[[4-[2-(carboxymethyl)-1,3-dioxoisoindol-5-yl]oxyphenyl]-diphenylmethyl]phenoxy]-1,3-dioxoisoindol-2-yl]acetic acid |
|---|---|
| PubChem CID | 146681736 |
| Molecular Formula | C45H30N2O10 |
| Molecular Weight | 758.74 g/mol |
| Exact Mass | 758.19 |
| IUPAC Name | 2-[5-[4-[[4-[2-(carboxymethyl)-1,3-dioxoisoindol-5-yl]oxyphenyl]-diphenylmethyl]phenoxy]-1,3-dioxoisoindol-2-yl]acetic acid |
| SMILES | O=C(O)CN1C(=O)c2ccc(Oc3ccc(C(c4ccccc4)(c4ccccc4)c4ccc(Oc5ccc6c(c5)C(=O)N(CC(=O)O)C6=O)cc4)cc3)cc2C1=O |
| InChI | InChI=1S/C45H30N2O10/c48-39(49)25-46-41(52)35-21-19-33(23-37(35)43(46)54)56-31-15-11-29(12-16-31)45(27-7-3-1-4-8-27,28-9-5-2-6-10-28)30-13-17-32(18-14-30)57-34-20-22-36-38(24-34)44(55)47(42(36)53)26-40(50)51/h1-24H,25-26H2,(H,48,49)(H,50,51) |
| InChIKey | NIIOUPZCXIMHII-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 167.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 758.74 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|