C21H24O5 — CID 146682039
(6aS)-3,6a-dimethyl-9-octanoylfuro[2,3-h]isochromene-6,8-dione (PubChem CID 146682039) has the molecular formula C21H24O5 and a molecular weight of 356.42 g/mol. Its IUPAC name is (6aS)-3,6a-dimethyl-9-octanoylfuro[2,3-h]isochromene-6,8-dione.
| Compound Name | (6aS)-3,6a-dimethyl-9-octanoylfuro[2,3-h]isochromene-6,8-dione |
|---|---|
| PubChem CID | 146682039 |
| Molecular Formula | C21H24O5 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | (6aS)-3,6a-dimethyl-9-octanoylfuro[2,3-h]isochromene-6,8-dione |
| SMILES | CCCCCCCC(=O)C1=C2C3=COC(C)=CC3=CC(=O)[C@@]2(C)OC1=O |
| InChI | InChI=1S/C21H24O5/c1-4-5-6-7-8-9-16(22)18-19-15-12-25-13(2)10-14(15)11-17(23)21(19,3)26-20(18)24/h10-12H,4-9H2,1-3H3/t21-/m1/s1 |
| InChIKey | YNVKQPJBOAUYIJ-OAQYLSRUSA-N |
| XLogP | 3.86 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|