C19H29NO3 — CID 146682053
(8S)-2-[(Z)-dodec-5-enoyl]-1-hydroxy-5,6,7,8-tetrahydropyrrolizin-3-one (PubChem CID 146682053) has the molecular formula C19H29NO3 and a molecular weight of 319.44 g/mol. Its IUPAC name is (8S)-2-[(Z)-dodec-5-enoyl]-1-hydroxy-5,6,7,8-tetrahydropyrrolizin-3-one.
| Compound Name | (8S)-2-[(Z)-dodec-5-enoyl]-1-hydroxy-5,6,7,8-tetrahydropyrrolizin-3-one |
|---|---|
| PubChem CID | 146682053 |
| Molecular Formula | C19H29NO3 |
| Molecular Weight | 319.44 g/mol |
| Exact Mass | 319.21 |
| IUPAC Name | (8S)-2-[(Z)-dodec-5-enoyl]-1-hydroxy-5,6,7,8-tetrahydropyrrolizin-3-one |
| SMILES | CCCCCC/C=C\CCCC(=O)C1=C(O)[C@@H]2CCCN2C1=O |
| InChI | InChI=1S/C19H29NO3/c1-2-3-4-5-6-7-8-9-10-13-16(21)17-18(22)15-12-11-14-20(15)19(17)23/h7-8,15,22H,2-6,9-14H2,1H3/b8-7-/t15-/m0/s1 |
| InChIKey | CEGXALHNHLDMPM-LZNQSLFOSA-N |
| XLogP | 4.07 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.44 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|