C21H33N7O5S2 — CID 146682174
(2S)-2-[[2-[(2S)-1-[(2S)-2-acetamido-5-(diaminomethylideneamino)pentanoyl]pyrrolidin-2-yl]-1,3-thiazole-4-carbonyl]amino]-4-methylsulfanylbutanoic acid (PubChem CID 146682174) has the molecular formula C21H33N7O5S2 and a molecular weight of 527.67 g/mol. Its IUPAC name is (2S)-2-[[2-[(2S)-1-[(2S)-2-acetamido-5-(diaminomethylideneamino)pentanoyl]pyrrolidin-2-yl]-1,3-thiazole-4-carbonyl]amino]-4-methylsulfanylbutanoic acid.
| Compound Name | (2S)-2-[[2-[(2S)-1-[(2S)-2-acetamido-5-(diaminomethylideneamino)pentanoyl]pyrrolidin-2-yl]-1,3-thiazole-4-carbonyl]amino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 146682174 |
| Molecular Formula | C21H33N7O5S2 |
| Molecular Weight | 527.67 g/mol |
| Exact Mass | 527.20 |
| IUPAC Name | (2S)-2-[[2-[(2S)-1-[(2S)-2-acetamido-5-(diaminomethylideneamino)pentanoyl]pyrrolidin-2-yl]-1,3-thiazole-4-carbonyl]amino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCC[C@H](NC(=O)c1csc([C@@H]2CCCN2C(=O)[C@H](CCCN=C(N)N)NC(C)=O)n1)C(=O)O |
| InChI | InChI=1S/C21H33N7O5S2/c1-12(29)25-13(5-3-8-24-21(22)23)19(31)28-9-4-6-16(28)18-27-15(11-35-18)17(30)26-14(20(32)33)7-10-34-2/h11,13-14,16H,3-10H2,1-2H3,(H,25,29)(H,26,30)(H,32,33)(H4,22,23,24)/t13-,14-,16-/m0/s1 |
| InChIKey | AFLLGKMKWFZARJ-DZKIICNBSA-N |
| XLogP | 0.30 |
| TPSA | 193.10 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.67 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|