C17H20O6 — CID 146682191
[(4R,5S,6R,7S,10R)-4,7-dihydroxy-3-methylidene-1-oxo-10-[(1E,3E)-penta-1,3-dienyl]-2-oxaspiro[4.5]dec-8-en-6-yl] acetate (PubChem CID 146682191) has the molecular formula C17H20O6 and a molecular weight of 320.34 g/mol. Its IUPAC name is [(4R,5S,6R,7S,10R)-4,7-dihydroxy-3-methylidene-1-oxo-10-[(1E,3E)-penta-1,3-dienyl]-2-oxaspiro[4.5]dec-8-en-6-yl] acetate.
| Compound Name | [(4R,5S,6R,7S,10R)-4,7-dihydroxy-3-methylidene-1-oxo-10-[(1E,3E)-penta-1,3-dienyl]-2-oxaspiro[4.5]dec-8-en-6-yl] acetate |
|---|---|
| PubChem CID | 146682191 |
| Molecular Formula | C17H20O6 |
| Molecular Weight | 320.34 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | [(4R,5S,6R,7S,10R)-4,7-dihydroxy-3-methylidene-1-oxo-10-[(1E,3E)-penta-1,3-dienyl]-2-oxaspiro[4.5]dec-8-en-6-yl] acetate |
| SMILES | C=C1OC(=O)[C@@]2([C@H](/C=C/C=C/C)C=C[C@H](O)[C@@H]2OC(C)=O)[C@H]1O |
| InChI | InChI=1S/C17H20O6/c1-4-5-6-7-12-8-9-13(19)15(23-11(3)18)17(12)14(20)10(2)22-16(17)21/h4-9,12-15,19-20H,2H2,1,3H3/b5-4+,7-6+/t12-,13+,14+,15+,17+/m1/s1 |
| InChIKey | ZVEIUEOBFDXLTO-FWBHNOMLSA-N |
| XLogP | 1.02 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.34 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|